C21H15F5N2O3 — CID 170241441
2-fluoro-6-[2-fluoro-4-(2,2,2-trifluoroethyl)phenoxy]-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide (PubChem CID 170241441) has the molecular formula C21H15F5N2O3 and a molecular weight of 438.35 g/mol. Its IUPAC name is 2-fluoro-6-[2-fluoro-4-(2,2,2-trifluoroethyl)phenoxy]-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide.
| Compound Name | 2-fluoro-6-[2-fluoro-4-(2,2,2-trifluoroethyl)phenoxy]-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide |
|---|---|
| PubChem CID | 170241441 |
| Molecular Formula | C21H15F5N2O3 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-fluoro-6-[2-fluoro-4-(2,2,2-trifluoroethyl)phenoxy]-3-methyl-N-(1-oxidopyridin-1-ium-3-yl)benzamide |
| SMILES | Cc1ccc(Oc2ccc(CC(F)(F)F)cc2F)c(C(=O)Nc2ccc[n+]([O-])c2)c1F |
| InChI | InChI=1S/C21H15F5N2O3/c1-12-4-6-17(31-16-7-5-13(9-15(16)22)10-21(24,25)26)18(19(12)23)20(29)27-14-3-2-8-28(30)11-14/h2-9,11H,10H2,1H3,(H,27,29) |
| InChIKey | OUCWENLIALQOBP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|