C18H10BrF4N3O4 — CID 167320496
3-bromo-2-fluoro-N-(2-oxidopyridazin-2-ium-4-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide (PubChem CID 167320496) has the molecular formula C18H10BrF4N3O4 and a molecular weight of 488.19 g/mol. Its IUPAC name is 3-bromo-2-fluoro-N-(2-oxidopyridazin-2-ium-4-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide.
| Compound Name | 3-bromo-2-fluoro-N-(2-oxidopyridazin-2-ium-4-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 167320496 |
| Molecular Formula | C18H10BrF4N3O4 |
| Molecular Weight | 488.19 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 3-bromo-2-fluoro-N-(2-oxidopyridazin-2-ium-4-yl)-6-[4-(trifluoromethoxy)phenoxy]benzamide |
| SMILES | O=C(Nc1ccn[n+]([O-])c1)c1c(Oc2ccc(OC(F)(F)F)cc2)ccc(Br)c1F |
| InChI | InChI=1S/C18H10BrF4N3O4/c19-13-5-6-14(29-11-1-3-12(4-2-11)30-18(21,22)23)15(16(13)20)17(27)25-10-7-8-24-26(28)9-10/h1-9H,(H,25,27) |
| InChIKey | SKEXVZGCTZOJJK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|