C19H14F4N4O5 — CID 170241430
3-fluoro-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-methyl-N-(2-oxidopyridazin-2-ium-4-yl)pyridine-4-carboxamide (PubChem CID 170241430) has the molecular formula C19H14F4N4O5 and a molecular weight of 454.34 g/mol. Its IUPAC name is 3-fluoro-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-methyl-N-(2-oxidopyridazin-2-ium-4-yl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-methyl-N-(2-oxidopyridazin-2-ium-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 170241430 |
| Molecular Formula | C19H14F4N4O5 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 3-fluoro-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-2-methyl-N-(2-oxidopyridazin-2-ium-4-yl)pyridine-4-carboxamide |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1cnc(C)c(F)c1C(=O)Nc1ccn[n+]([O-])c1 |
| InChI | InChI=1S/C19H14F4N4O5/c1-10-17(20)16(18(28)26-11-5-6-25-27(29)9-11)15(8-24-10)31-13-4-3-12(7-14(13)30-2)32-19(21,22)23/h3-9H,1-2H3,(H,26,28) |
| InChIKey | FVSALGUVFIZJMK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|