C16H14F3NO6 — CID 137406864
methyl 3-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-4-carboxylate (PubChem CID 137406864) has the molecular formula C16H14F3NO6 and a molecular weight of 373.28 g/mol. Its IUPAC name is methyl 3-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-4-carboxylate.
| Compound Name | methyl 3-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 137406864 |
| Molecular Formula | C16H14F3NO6 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 3-methoxy-5-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-4-carboxylate |
| SMILES | COC(=O)c1c(OC)cncc1Oc1ccc(OC(F)(F)F)cc1OC |
| InChI | InChI=1S/C16H14F3NO6/c1-22-11-6-9(26-16(17,18)19)4-5-10(11)25-13-8-20-7-12(23-2)14(13)15(21)24-3/h4-8H,1-3H3 |
| InChIKey | KEZZUAWIRABBAM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |