C18H19F3N2O4 — CID 154645452
5-tert-butyl-3-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-2-carboxamide (PubChem CID 154645452) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 5-tert-butyl-3-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-2-carboxamide.
| Compound Name | 5-tert-butyl-3-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154645452 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 5-tert-butyl-3-[2-methoxy-4-(trifluoromethoxy)phenoxy]pyridine-2-carboxamide |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1cc(C(C)(C)C)cnc1C(N)=O |
| InChI | InChI=1S/C18H19F3N2O4/c1-17(2,3)10-7-14(15(16(22)24)23-9-10)26-12-6-5-11(8-13(12)25-4)27-18(19,20)21/h5-9H,1-4H3,(H2,22,24) |
| InChIKey | LIYPLUYCLSPMPN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |