C15H8ClF6NO4 — CID 137406655
3-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-2-carbonyl chloride (PubChem CID 137406655) has the molecular formula C15H8ClF6NO4 and a molecular weight of 415.67 g/mol. Its IUPAC name is 3-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-2-carbonyl chloride.
| Compound Name | 3-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 137406655 |
| Molecular Formula | C15H8ClF6NO4 |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-[2-methoxy-4-(trifluoromethoxy)phenoxy]-5-(trifluoromethyl)pyridine-2-carbonyl chloride |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1cc(C(F)(F)F)cnc1C(=O)Cl |
| InChI | InChI=1S/C15H8ClF6NO4/c1-25-10-5-8(27-15(20,21)22)2-3-9(10)26-11-4-7(14(17,18)19)6-23-12(11)13(16)24/h2-6H,1H3 |
| InChIKey | HIOGJUQBVZAXBS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|