C15H11F6NO3 — CID 170311859
5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-3-methyl-2-(trifluoromethyl)pyridine (PubChem CID 170311859) has the molecular formula C15H11F6NO3 and a molecular weight of 367.25 g/mol. Its IUPAC name is 5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-3-methyl-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-3-methyl-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 170311859 |
| Molecular Formula | C15H11F6NO3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 5-[2-methoxy-4-(trifluoromethoxy)phenoxy]-3-methyl-2-(trifluoromethyl)pyridine |
| SMILES | COc1cc(OC(F)(F)F)ccc1Oc1cnc(C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C15H11F6NO3/c1-8-5-10(7-22-13(8)14(16,17)18)24-11-4-3-9(6-12(11)23-2)25-15(19,20)21/h3-7H,1-2H3 |
| InChIKey | VSLXMCCNPZHUBH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |