C14H10F4N2O4 — CID 167198498
methyl 3-(4-fluoro-2-methoxyphenoxy)-6-(trifluoromethyl)pyridazine-4-carboxylate (PubChem CID 167198498) has the molecular formula C14H10F4N2O4 and a molecular weight of 346.24 g/mol. Its IUPAC name is methyl 3-(4-fluoro-2-methoxyphenoxy)-6-(trifluoromethyl)pyridazine-4-carboxylate.
| Compound Name | methyl 3-(4-fluoro-2-methoxyphenoxy)-6-(trifluoromethyl)pyridazine-4-carboxylate |
|---|---|
| PubChem CID | 167198498 |
| Molecular Formula | C14H10F4N2O4 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | methyl 3-(4-fluoro-2-methoxyphenoxy)-6-(trifluoromethyl)pyridazine-4-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)nnc1Oc1ccc(F)cc1OC |
| InChI | InChI=1S/C14H10F4N2O4/c1-22-10-5-7(15)3-4-9(10)24-12-8(13(21)23-2)6-11(19-20-12)14(16,17)18/h3-6H,1-2H3 |
| InChIKey | XVUOVPCDECIIKP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |