C22H20F3NO3S — CID 23355281
3-(4-ethylphenyl)-6-methoxy-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyridine (PubChem CID 23355281) has the molecular formula C22H20F3NO3S and a molecular weight of 435.47 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-6-methoxy-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyridine.
| Compound Name | 3-(4-ethylphenyl)-6-methoxy-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 23355281 |
| Molecular Formula | C22H20F3NO3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-(4-ethylphenyl)-6-methoxy-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)pyridine |
| SMILES | CCc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)cc(OC)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F3NO3S/c1-4-14-5-7-16(8-6-14)20-18(13-19(29-2)26-21(20)22(23,24)25)15-9-11-17(12-10-15)30(3,27)28/h5-13H,4H2,1-3H3 |
| InChIKey | GKUBEULELXHJTC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |