C19H19F3N2O3S — CID 22998091
2-(4-ethylphenyl)-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol (PubChem CID 22998091) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol.
| Compound Name | 2-(4-ethylphenyl)-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol |
|---|---|
| PubChem CID | 22998091 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-(4-ethylphenyl)-3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol |
| SMILES | CCc1ccc(C2=NC(O)(C(F)(F)F)CN2c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H19F3N2O3S/c1-3-13-4-6-14(7-5-13)17-23-18(25,19(20,21)22)12-24(17)15-8-10-16(11-9-15)28(2,26)27/h4-11,25H,3,12H2,1-2H3 |
| InChIKey | APKAJZFDOXSDFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |