C17H16F3N3O2S — CID 162579127
4-[5-methyl-2-phenyl-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide (PubChem CID 162579127) has the molecular formula C17H16F3N3O2S and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[5-methyl-2-phenyl-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[5-methyl-2-phenyl-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162579127 |
| Molecular Formula | C17H16F3N3O2S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[5-methyl-2-phenyl-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide |
| SMILES | CC1(C(F)(F)F)CN(c2ccc(S(N)(=O)=O)cc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H16F3N3O2S/c1-16(17(18,19)20)11-23(15(22-16)12-5-3-2-4-6-12)13-7-9-14(10-8-13)26(21,24)25/h2-10H,11H2,1H3,(H2,21,24,25) |
| InChIKey | MNWSPIIVRMSPPI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |