C16H13F4N3O3S — CID 22998209
4-[2-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide (PubChem CID 22998209) has the molecular formula C16H13F4N3O3S and a molecular weight of 403.36 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[2-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22998209 |
| Molecular Formula | C16H13F4N3O3S |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-imidazol-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CC(O)(C(F)(F)F)N=C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H13F4N3O3S/c17-11-3-1-10(2-4-11)14-22-15(24,16(18,19)20)9-23(14)12-5-7-13(8-6-12)27(21,25)26/h1-8,24H,9H2,(H2,21,25,26) |
| InChIKey | HDTRNAXKCLBKBP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |