C23H27ClN2O4S — CID 22998051
1-[2-(4-chlorophenyl)-5-hydroxy-3-(4-methylsulfonylphenyl)-4H-imidazol-5-yl]heptan-1-one (PubChem CID 22998051) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-5-hydroxy-3-(4-methylsulfonylphenyl)-4H-imidazol-5-yl]heptan-1-one.
| Compound Name | 1-[2-(4-chlorophenyl)-5-hydroxy-3-(4-methylsulfonylphenyl)-4H-imidazol-5-yl]heptan-1-one |
|---|---|
| PubChem CID | 22998051 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-5-hydroxy-3-(4-methylsulfonylphenyl)-4H-imidazol-5-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)C1(O)CN(c2ccc(S(C)(=O)=O)cc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H27ClN2O4S/c1-3-4-5-6-7-21(27)23(28)16-26(19-12-14-20(15-13-19)31(2,29)30)22(25-23)17-8-10-18(24)11-9-17/h8-15,28H,3-7,16H2,1-2H3 |
| InChIKey | HHIVNBVLHWNACU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|