C17H14BrF3N2O3S — CID 22997835
3-(4-bromophenyl)-2-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol (PubChem CID 22997835) has the molecular formula C17H14BrF3N2O3S and a molecular weight of 463.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol.
| Compound Name | 3-(4-bromophenyl)-2-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol |
|---|---|
| PubChem CID | 22997835 |
| Molecular Formula | C17H14BrF3N2O3S |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 3-(4-bromophenyl)-2-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-4H-imidazol-5-ol |
| SMILES | CS(=O)(=O)c1ccc(C2=NC(O)(C(F)(F)F)CN2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H14BrF3N2O3S/c1-27(25,26)14-8-2-11(3-9-14)15-22-16(24,17(19,20)21)10-23(15)13-6-4-12(18)5-7-13/h2-9,24H,10H2,1H3 |
| InChIKey | UHZOFQQCFOXSQT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |