C21H21F2NO3P2S — CID 143004384
[1,2-difluoro-1-[6-methoxy-4-(4-methylsulfonylphenyl)-3-(4-phosphanylphenyl)-2-pyridinyl]ethyl]phosphane (PubChem CID 143004384) has the molecular formula C21H21F2NO3P2S and a molecular weight of 467.41 g/mol. Its IUPAC name is [1,2-difluoro-1-[6-methoxy-4-(4-methylsulfonylphenyl)-3-(4-phosphanylphenyl)-2-pyridinyl]ethyl]phosphane.
| Compound Name | [1,2-difluoro-1-[6-methoxy-4-(4-methylsulfonylphenyl)-3-(4-phosphanylphenyl)-2-pyridinyl]ethyl]phosphane |
|---|---|
| PubChem CID | 143004384 |
| Molecular Formula | C21H21F2NO3P2S |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | [1,2-difluoro-1-[6-methoxy-4-(4-methylsulfonylphenyl)-3-(4-phosphanylphenyl)-2-pyridinyl]ethyl]phosphane |
| SMILES | COc1cc(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccc(P)cc2)c(C(F)(P)CF)n1 |
| InChI | InChI=1S/C21H21F2NO3P2S/c1-27-18-11-17(13-5-9-16(10-6-13)30(2,25)26)19(14-3-7-15(28)8-4-14)20(24-18)21(23,29)12-22/h3-11H,12,28-29H2,1-2H3 |
| InChIKey | ZXFVBXMYXYPKFU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|