C13H12F3N3O2S — CID 145380726
3-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-6-methylpyridazine (PubChem CID 145380726) has the molecular formula C13H12F3N3O2S and a molecular weight of 331.32 g/mol. Its IUPAC name is 3-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-6-methylpyridazine.
| Compound Name | 3-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-6-methylpyridazine |
|---|---|
| PubChem CID | 145380726 |
| Molecular Formula | C13H12F3N3O2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-6-methylpyridazine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1ccc(C)nn1 |
| InChI | InChI=1S/C13H12F3N3O2S/c1-3-22(20,21)11-6-9(13(14,15)16)7-17-12(11)10-5-4-8(2)18-19-10/h4-7H,3H2,1-2H3 |
| InChIKey | HIBTVQZZPQGDLP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |