C14H8F8N4O2S2 — CID 118181867
6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 118181867) has the molecular formula C14H8F8N4O2S2 and a molecular weight of 480.36 g/mol. Its IUPAC name is 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 118181867 |
| Molecular Formula | C14H8F8N4O2S2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 6-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1cn2nc(C(F)(F)C(F)(F)F)sc2n1 |
| InChI | InChI=1S/C14H8F8N4O2S2/c1-2-30(27,28)8-3-6(13(17,18)19)4-23-9(8)7-5-26-11(24-7)29-10(25-26)12(15,16)14(20,21)22/h3-5H,2H2,1H3 |
| InChIKey | IZHRJRROTDEPFD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|