C19H21F3N4O5S — CID 118570981
2-[3-ethylsulfonyl-5-(trimethoxymethyl)-2-pyridinyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 118570981) has the molecular formula C19H21F3N4O5S and a molecular weight of 474.46 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-5-(trimethoxymethyl)-2-pyridinyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-[3-ethylsulfonyl-5-(trimethoxymethyl)-2-pyridinyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 118570981 |
| Molecular Formula | C19H21F3N4O5S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-[3-ethylsulfonyl-5-(trimethoxymethyl)-2-pyridinyl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(OC)(OC)OC)cnc1-c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C19H21F3N4O5S/c1-6-32(27,28)14-8-12(19(29-3,30-4)31-5)10-23-15(14)17-25-13-7-11(18(20,21)22)9-24-16(13)26(17)2/h7-10H,6H2,1-5H3 |
| InChIKey | YKNJVKXYLONGJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|