C16H14ClF3N4O2S — CID 118581452
5-chloro-2-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3,6-dimethylimidazo[4,5-b]pyridine (PubChem CID 118581452) has the molecular formula C16H14ClF3N4O2S and a molecular weight of 418.83 g/mol. Its IUPAC name is 5-chloro-2-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3,6-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3,6-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 118581452 |
| Molecular Formula | C16H14ClF3N4O2S |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 5-chloro-2-[3-ethylsulfonyl-5-(trifluoromethyl)-2-pyridinyl]-3,6-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1nc2cc(C)c(Cl)nc2n1C |
| InChI | InChI=1S/C16H14ClF3N4O2S/c1-4-27(25,26)11-6-9(16(18,19)20)7-21-12(11)15-22-10-5-8(2)13(17)23-14(10)24(15)3/h5-7H,4H2,1-3H3 |
| InChIKey | LMNAXBJYMWILBH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|