C17H14F4N4O2S — CID 129040706
3-ethylsulfonyl-2-[5-(6-fluoro-3-pyridinyl)-1-methylimidazol-2-yl]-5-(trifluoromethyl)pyridine (PubChem CID 129040706) has the molecular formula C17H14F4N4O2S and a molecular weight of 414.38 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[5-(6-fluoro-3-pyridinyl)-1-methylimidazol-2-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-ethylsulfonyl-2-[5-(6-fluoro-3-pyridinyl)-1-methylimidazol-2-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 129040706 |
| Molecular Formula | C17H14F4N4O2S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-ethylsulfonyl-2-[5-(6-fluoro-3-pyridinyl)-1-methylimidazol-2-yl]-5-(trifluoromethyl)pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1ncc(-c2ccc(F)nc2)n1C |
| InChI | InChI=1S/C17H14F4N4O2S/c1-3-28(26,27)13-6-11(17(19,20)21)8-23-15(13)16-24-9-12(25(16)2)10-4-5-14(18)22-7-10/h4-9H,3H2,1-2H3 |
| InChIKey | OFNBXUCKTFZVNU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|