C23H18F5N4O4S+ — CID 163909256
CID 163909256 (PubChem CID 163909256) has the molecular formula C23H18F5N4O4S+ and a molecular weight of 541.48 g/mol.
| Compound Name | CID 163909256 |
|---|---|
| PubChem CID | 163909256 |
| Molecular Formula | C23H18F5N4O4S+ |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)(O)c1cc(Oc2ccccn2)cnc1-c1cc2ccc(=O)n(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C23H17F5N4O4S/c1-2-37(34,35)18-10-15(36-19-5-3-4-8-29-19)11-31-21(18)16-9-14-6-7-20(33)32(17(14)12-30-16)13-22(24,25)23(26,27)28/h3-12H,2,13H2,1H3/p+1 |
| InChIKey | QQQYJJZPJQMEDT-UHFFFAOYSA-O |
| XLogP | 5.19 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|