C13H7F6NO — CID 90899440
2-[3,5-bis(trifluoromethyl)phenoxy]pyridine (PubChem CID 90899440) has the molecular formula C13H7F6NO and a molecular weight of 307.19 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]pyridine.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]pyridine |
|---|---|
| PubChem CID | 90899440 |
| Molecular Formula | C13H7F6NO |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]pyridine |
| SMILES | FC(F)(F)c1cc(Oc2ccccn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F6NO/c14-12(15,16)8-5-9(13(17,18)19)7-10(6-8)21-11-3-1-2-4-20-11/h1-7H |
| InChIKey | XPHQVAHGRIYCOG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |