C20H17F3N4O3 — CID 58503865
propan-2-yl (Z)-3-[3-[3-pyridin-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 58503865) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[3-[3-pyridin-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[3-[3-pyridin-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58503865 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | propan-2-yl (Z)-3-[3-[3-pyridin-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\n1cnc(-c2cc(Oc3ccccn3)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-13(2)29-18(28)6-8-27-12-25-19(26-27)14-9-15(20(21,22)23)11-16(10-14)30-17-5-3-4-7-24-17/h3-13H,1-2H3/b8-6- |
| InChIKey | ZWRFGYIMQOGRLE-VURMDHGXSA-N |
| XLogP | 4.57 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|