C16H13F6N3O3 — CID 58503789
propan-2-yl (Z)-3-[3-[3-(trifluoromethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 58503789) has the molecular formula C16H13F6N3O3 and a molecular weight of 409.29 g/mol. Its IUPAC name is propan-2-yl (Z)-3-[3-[3-(trifluoromethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
| Compound Name | propan-2-yl (Z)-3-[3-[3-(trifluoromethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58503789 |
| Molecular Formula | C16H13F6N3O3 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | propan-2-yl (Z)-3-[3-[3-(trifluoromethoxy)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)/C=C\n1cnc(-c2cc(OC(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H13F6N3O3/c1-9(2)27-13(26)3-4-25-8-23-14(24-25)10-5-11(15(17,18)19)7-12(6-10)28-16(20,21)22/h3-9H,1-2H3/b4-3- |
| InChIKey | ZBZZOSTXUCJNMD-ARJAWSKDSA-N |
| XLogP | 4.28 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|