C15H14F6N4O — CID 166138058
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide;ethane (PubChem CID 166138058) has the molecular formula C15H14F6N4O and a molecular weight of 380.29 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide;ethane.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 166138058 |
| Molecular Formula | C15H14F6N4O |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide;ethane |
| SMILES | CC.NC(=O)/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H8F6N4O.C2H6/c14-12(15,16)8-3-7(4-9(5-8)13(17,18)19)11-21-6-23(22-11)2-1-10(20)24;1-2/h1-6H,(H2,20,24);1-2H3/b2-1-; |
| InChIKey | SNPQAAJVLLQIHN-ODZAUARKSA-N |
| XLogP | 3.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|