C16H13F6N5O — CID 154689308
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-pyrazolidin-1-ylprop-2-en-1-one (PubChem CID 154689308) has the molecular formula C16H13F6N5O and a molecular weight of 405.30 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-pyrazolidin-1-ylprop-2-en-1-one.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-pyrazolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 154689308 |
| Molecular Formula | C16H13F6N5O |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-1-pyrazolidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)N1CCCN1 |
| InChI | InChI=1S/C16H13F6N5O/c17-15(18,19)11-6-10(7-12(8-11)16(20,21)22)14-23-9-26(25-14)5-2-13(28)27-4-1-3-24-27/h2,5-9,24H,1,3-4H2/b5-2- |
| InChIKey | HWGQUNHGMWSOQU-DJWKRKHSSA-N |
| XLogP | 3.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|