C17H16F6N5O2+ — CID 144523477
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-morpholin-4-ium-4-ylprop-2-enamide (PubChem CID 144523477) has the molecular formula C17H16F6N5O2+ and a molecular weight of 436.34 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-morpholin-4-ium-4-ylprop-2-enamide.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-morpholin-4-ium-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 144523477 |
| Molecular Formula | C17H16F6N5O2+ |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-morpholin-4-ium-4-ylprop-2-enamide |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)N[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H15F6N5O2/c18-16(19,20)12-7-11(8-13(9-12)17(21,22)23)15-24-10-28(26-15)2-1-14(29)25-27-3-5-30-6-4-27/h1-2,7-10H,3-6H2,(H,25,29)/p+1/b2-1- |
| InChIKey | FTNRWLCDWABQRQ-UPHRSURJSA-O |
| XLogP | 1.40 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|