C18H21F3N7O3+ — CID 157378510
[2-[(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-(morpholin-4-ylmethyl)-oxoazanium (PubChem CID 157378510) has the molecular formula C18H21F3N7O3+ and a molecular weight of 440.41 g/mol. Its IUPAC name is [2-[(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-(morpholin-4-ylmethyl)-oxoazanium.
| Compound Name | [2-[(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-(morpholin-4-ylmethyl)-oxoazanium |
|---|---|
| PubChem CID | 157378510 |
| Molecular Formula | C18H21F3N7O3+ |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [2-[(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-(morpholin-4-ylmethyl)-oxoazanium |
| SMILES | Cc1cc(-c2ncn(/C=C\C(=O)NN[N+](=O)CN3CCOCC3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N7O3/c1-13-8-14(10-15(9-13)18(19,20)21)17-22-11-27(24-17)3-2-16(29)23-25-28(30)12-26-4-6-31-7-5-26/h2-3,8-11H,4-7,12H2,1H3,(H-,22,23,24,25,29,30)/p+1 |
| InChIKey | ZVXCIALCVCAYRD-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|