C17H15F8N5O3S — CID 146270594
N'-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide (PubChem CID 146270594) has the molecular formula C17H15F8N5O3S and a molecular weight of 521.39 g/mol. Its IUPAC name is N'-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide.
| Compound Name | N'-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide |
|---|---|
| PubChem CID | 146270594 |
| Molecular Formula | C17H15F8N5O3S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | N'-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1)NNC(=O)C1CCOC1 |
| InChI | InChI=1S/C17H15F8N5O3S/c18-17(19,20)12-5-11(6-13(7-12)34(21,22,23,24)25)15-26-9-30(29-15)3-1-14(31)27-28-16(32)10-2-4-33-8-10/h1,3,5-7,9-10H,2,4,8H2,(H,27,31)(H,28,32)/b3-1- |
| InChIKey | ITZCJZNQRIXMRI-IWQZZHSRSA-N |
| XLogP | 4.28 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|