C16H13F8N5O2S — CID 174208838
N-[[1-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]cyclopropyl]amino]formamide (PubChem CID 174208838) has the molecular formula C16H13F8N5O2S and a molecular weight of 491.36 g/mol. Its IUPAC name is N-[[1-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]cyclopropyl]amino]formamide.
| Compound Name | N-[[1-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]cyclopropyl]amino]formamide |
|---|---|
| PubChem CID | 174208838 |
| Molecular Formula | C16H13F8N5O2S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[[1-[(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]cyclopropyl]amino]formamide |
| SMILES | O=CNNC1(C(=O)/C=C\n2cnc(-c3cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C16H13F8N5O2S/c17-16(18,19)11-5-10(6-12(7-11)32(20,21,22,23)24)14-25-8-29(27-14)4-1-13(31)15(2-3-15)28-26-9-30/h1,4-9,28H,2-3H2,(H,26,30)/b4-1- |
| InChIKey | IKAUZILHDQAVID-RJRFIUFISA-N |
| XLogP | 4.44 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|