C16H15F8N7OS — CID 170235954
(Z)-N'-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide (PubChem CID 170235954) has the molecular formula C16H15F8N7OS and a molecular weight of 505.40 g/mol. Its IUPAC name is (Z)-N'-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide.
| Compound Name | (Z)-N'-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 170235954 |
| Molecular Formula | C16H15F8N7OS |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (Z)-N'-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
| SMILES | N/C=C\C=C(/N)NNC(=O)/C=C\n1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H15F8N7OS/c17-16(18,19)11-6-10(7-12(8-11)33(20,21,22,23)24)15-27-9-31(30-15)5-3-14(32)29-28-13(26)2-1-4-25/h1-9,28H,25-26H2,(H,29,32)/b4-1-,5-3-,13-2+ |
| InChIKey | ODQHOIMHLKQVKI-UOFZTXEPSA-N |
| XLogP | 3.99 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|