C15H13F8N5O2S — CID 146270574
(Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-propanoylprop-2-enehydrazide (PubChem CID 146270574) has the molecular formula C15H13F8N5O2S and a molecular weight of 479.35 g/mol. Its IUPAC name is (Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-propanoylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-propanoylprop-2-enehydrazide |
|---|---|
| PubChem CID | 146270574 |
| Molecular Formula | C15H13F8N5O2S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | (Z)-3-[3-[3-(pentafluoro-λ6-sulfanyl)-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-propanoylprop-2-enehydrazide |
| SMILES | CCC(=O)NNC(=O)/C=C\n1cnc(-c2cc(C(F)(F)F)cc(S(F)(F)(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H13F8N5O2S/c1-2-12(29)25-26-13(30)3-4-28-8-24-14(27-28)9-5-10(15(16,17)18)7-11(6-9)31(19,20,21,22)23/h3-8H,2H2,1H3,(H,25,29)(H,26,30)/b4-3- |
| InChIKey | JTGWHFVJUWUQSJ-ARJAWSKDSA-N |
| XLogP | 4.65 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|