C20H17F9N6O3 — CID 90077755
N-[(2S)-1-[2-[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 90077755) has the molecular formula C20H17F9N6O3 and a molecular weight of 560.38 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-1-[2-[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90077755 |
| Molecular Formula | C20H17F9N6O3 |
| Molecular Weight | 560.38 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | N-[(2S)-1-[2-[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)[C@H](NC(=O)C(F)(F)F)C(=O)NNC(=O)/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H17F9N6O3/c1-9(2)14(31-17(38)20(27,28)29)16(37)33-32-13(36)3-4-35-8-30-15(34-35)10-5-11(18(21,22)23)7-12(6-10)19(24,25)26/h3-9,14H,1-2H3,(H,31,38)(H,32,36)(H,33,37)/b4-3-/t14-/m0/s1 |
| InChIKey | KDESDHPCIZSOEF-NQHOJNORSA-N |
| XLogP | 3.30 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|