C16H12F6IN5O2 — CID 89403778
[1-[[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]azetidin-3-yl] hypoiodite (PubChem CID 89403778) has the molecular formula C16H12F6IN5O2 and a molecular weight of 547.20 g/mol. Its IUPAC name is [1-[[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]azetidin-3-yl] hypoiodite.
| Compound Name | [1-[[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]azetidin-3-yl] hypoiodite |
|---|---|
| PubChem CID | 89403778 |
| Molecular Formula | C16H12F6IN5O2 |
| Molecular Weight | 547.20 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | [1-[[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]azetidin-3-yl] hypoiodite |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)NN1CC(OI)C1 |
| InChI | InChI=1S/C16H12F6IN5O2/c17-15(18,19)10-3-9(4-11(5-10)16(20,21)22)14-24-8-27(26-14)2-1-13(29)25-28-6-12(7-28)30-23/h1-5,8,12H,6-7H2,(H,25,29)/b2-1- |
| InChIKey | ADBUPBHFGFHCCO-UPHRSURJSA-N |
| XLogP | 3.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|