C20H16F6N6O — CID 123970454
3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-[1-(5-methylpyrimidin-2-yl)ethyl]prop-2-enamide (PubChem CID 123970454) has the molecular formula C20H16F6N6O and a molecular weight of 470.38 g/mol. Its IUPAC name is 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-[1-(5-methylpyrimidin-2-yl)ethyl]prop-2-enamide.
| Compound Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-[1-(5-methylpyrimidin-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 123970454 |
| Molecular Formula | C20H16F6N6O |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N-[1-(5-methylpyrimidin-2-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cnc(C(C)NC(=O)C=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)nc1 |
| InChI | InChI=1S/C20H16F6N6O/c1-11-8-27-17(28-9-11)12(2)30-16(33)3-4-32-10-29-18(31-32)13-5-14(19(21,22)23)7-15(6-13)20(24,25)26/h3-10,12H,1-2H3,(H,30,33) |
| InChIKey | AACVCOZXYFSUIK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|