C20H17F3N6O2 — CID 118281110
(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(2-pyridin-3-ylacetyl)prop-2-enehydrazide (PubChem CID 118281110) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(2-pyridin-3-ylacetyl)prop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(2-pyridin-3-ylacetyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 118281110 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-(2-pyridin-3-ylacetyl)prop-2-enehydrazide |
| SMILES | Cc1cc(-c2ncn(/C=C\C(=O)NNC(=O)Cc3cccnc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F3N6O2/c1-13-7-15(10-16(8-13)20(21,22)23)19-25-12-29(28-19)6-4-17(30)26-27-18(31)9-14-3-2-5-24-11-14/h2-8,10-12H,9H2,1H3,(H,26,30)(H,27,31)/b6-4- |
| InChIKey | HZQZDMLJZLLIQZ-XQRVVYSFSA-N |
| XLogP | 2.53 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|