C18H12F3N7O — CID 171037090
(Z)-3-[3-[3-ethynyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyrazin-2-ylprop-2-enehydrazide (PubChem CID 171037090) has the molecular formula C18H12F3N7O and a molecular weight of 399.34 g/mol. Its IUPAC name is (Z)-3-[3-[3-ethynyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyrazin-2-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-ethynyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyrazin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 171037090 |
| Molecular Formula | C18H12F3N7O |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (Z)-3-[3-[3-ethynyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyrazin-2-ylprop-2-enehydrazide |
| SMILES | C#Cc1cc(-c2ncn(/C=C\C(=O)NNc3cnccn3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3N7O/c1-2-12-7-13(9-14(8-12)18(19,20)21)17-24-11-28(27-17)6-3-16(29)26-25-15-10-22-4-5-23-15/h1,3-11H,(H,23,25)(H,26,29)/b6-3- |
| InChIKey | KBYZNDKIDORBCT-UTCJRWHESA-N |
| XLogP | 2.35 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|