C36H37ClN12O2 — CID 159144861
bis((Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide);hydrochloride (PubChem CID 159144861) has the molecular formula C36H37ClN12O2 and a molecular weight of 705.23 g/mol. Its IUPAC name is bis((Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide);hydrochloride.
| Compound Name | bis((Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide);hydrochloride |
|---|---|
| PubChem CID | 159144861 |
| Molecular Formula | C36H37ClN12O2 |
| Molecular Weight | 705.23 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | bis((Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide);hydrochloride |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C\C(=O)NNc3ccccn3)n2)c1.Cc1cc(C)cc(-c2ncn(/C=C\C(=O)NNc3ccccn3)n2)c1.Cl |
| InChI | InChI=1S/2C18H18N6O.ClH/c2*1-13-9-14(2)11-15(10-13)18-20-12-24(23-18)8-6-17(25)22-21-16-5-3-4-7-19-16;/h2*3-12H,1-2H3,(H,19,21)(H,22,25);1H/b2*8-6-; |
| InChIKey | WALOGKJAGBLPDE-HIGYRTBYSA-N |
| XLogP | 5.56 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|