C14H15N3O — CID 159085340
(Z)-4-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]but-3-en-2-one (PubChem CID 159085340) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is (Z)-4-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]but-3-en-2-one.
| Compound Name | (Z)-4-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 159085340 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (Z)-4-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C\n1cnc(-c2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C14H15N3O/c1-10-6-11(2)8-13(7-10)14-15-9-17(16-14)5-4-12(3)18/h4-9H,1-3H3/b5-4- |
| InChIKey | RPJMIOXIJKNHJS-PLNGDYQASA-N |
| XLogP | 2.62 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|