C13H12BrN3O2 — CID 121367955
(E)-2-bromo-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid (PubChem CID 121367955) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is (E)-2-bromo-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid.
| Compound Name | (E)-2-bromo-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 121367955 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | (E)-2-bromo-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C(/Br)C(=O)O)n2)c1 |
| InChI | InChI=1S/C13H12BrN3O2/c1-8-3-9(2)5-10(4-8)12-15-7-17(16-12)6-11(14)13(18)19/h3-7H,1-2H3,(H,18,19)/b11-6+ |
| InChIKey | INSQSQOPZBCPAI-IZZDOVSWSA-N |
| XLogP | 2.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|