C19H16N6O — CID 158162962
(E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(5-isocyano-3-pyridinyl)prop-2-enamide (PubChem CID 158162962) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(5-isocyano-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(5-isocyano-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 158162962 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(5-isocyano-3-pyridinyl)prop-2-enamide |
| SMILES | [C-]#[N+]c1cncc(/C(=C\n2cnc(-c3cc(C)cc(C)c3)n2)C(N)=O)c1 |
| InChI | InChI=1S/C19H16N6O/c1-12-4-13(2)6-14(5-12)19-23-11-25(24-19)10-17(18(20)26)15-7-16(21-3)9-22-8-15/h4-11H,1-2H3,(H2,20,26)/b17-10+ |
| InChIKey | JRUXYIAQJRLFBM-LICLKQGHSA-N |
| XLogP | 2.99 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|