C18H16FN5O — CID 121367887
(E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide (PubChem CID 121367887) has the molecular formula C18H16FN5O and a molecular weight of 337.36 g/mol. Its IUPAC name is (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 121367887 |
| Molecular Formula | C18H16FN5O |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C(/C(N)=O)c3cccc(F)n3)n2)c1 |
| InChI | InChI=1S/C18H16FN5O/c1-11-6-12(2)8-13(7-11)18-21-10-24(23-18)9-14(17(20)25)15-4-3-5-16(19)22-15/h3-10H,1-2H3,(H2,20,25)/b14-9+ |
| InChIKey | ATPSPFSQEUHRNI-NTEUORMPSA-N |
| XLogP | 2.58 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|