C22H22FN5O3S — CID 160694648
(E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 160694648) has the molecular formula C22H22FN5O3S and a molecular weight of 455.52 g/mol. Its IUPAC name is (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 160694648 |
| Molecular Formula | C22H22FN5O3S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (E)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]-2-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C(/C(N)=O)c3ccc(S(=O)(=O)N4CC(F)C4)cc3)n2)c1 |
| InChI | InChI=1S/C22H22FN5O3S/c1-14-7-15(2)9-17(8-14)22-25-13-27(26-22)12-20(21(24)29)16-3-5-19(6-4-16)32(30,31)28-10-18(23)11-28/h3-9,12-13,18H,10-11H2,1-2H3,(H2,24,29)/b20-12+ |
| InChIKey | RPVNYNYHDFKALU-UDWIEESQSA-N |
| XLogP | 2.39 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|