C22H20F4N4O — CID 174074268
(E)-2-[(1E,3Z)-8-fluorocyclonona-1,3,8-trien-1-yl]-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide (PubChem CID 174074268) has the molecular formula C22H20F4N4O and a molecular weight of 432.42 g/mol. Its IUPAC name is (E)-2-[(1E,3Z)-8-fluorocyclonona-1,3,8-trien-1-yl]-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide.
| Compound Name | (E)-2-[(1E,3Z)-8-fluorocyclonona-1,3,8-trien-1-yl]-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174074268 |
| Molecular Formula | C22H20F4N4O |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (E)-2-[(1E,3Z)-8-fluorocyclonona-1,3,8-trien-1-yl]-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
| SMILES | Cc1cc(-c2ncn(/C=C(C(N)=O)\C3=C\C=C/CCCC(F)=C3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F4N4O/c1-14-8-16(10-17(9-14)22(24,25)26)21-28-13-30(29-21)12-19(20(27)31)15-6-4-2-3-5-7-18(23)11-15/h2,4,6,8-13H,3,5,7H2,1H3,(H2,27,31)/b4-2-,15-6+,18-11?,19-12+ |
| InChIKey | KVMKTHIGUWMJOL-IUMYJGOPSA-N |
| XLogP | 5.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|