C16H9F6N5OS — CID 86580949
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 86580949) has the molecular formula C16H9F6N5OS and a molecular weight of 433.34 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86580949 |
| Molecular Formula | C16H9F6N5OS |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1nccs1 |
| InChI | InChI=1S/C16H9F6N5OS/c17-15(18,19)9-3-8(4-10(5-9)16(20,21)22)13-25-7-27(26-13)6-11(12(23)28)14-24-1-2-29-14/h1-7H,(H2,23,28)/b11-6- |
| InChIKey | OAYKTDRMWHCODC-WDZFZDKYSA-N |
| XLogP | 3.92 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|