C18H13F4N5O — CID 130346756
(Z)-2-(6-fluoro-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide (PubChem CID 130346756) has the molecular formula C18H13F4N5O and a molecular weight of 391.33 g/mol. Its IUPAC name is (Z)-2-(6-fluoro-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-(6-fluoro-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 130346756 |
| Molecular Formula | C18H13F4N5O |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (Z)-2-(6-fluoro-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enamide |
| SMILES | Cc1cc(-c2ncn(/C=C(\C(N)=O)c3ccc(F)nc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F4N5O/c1-10-4-12(6-13(5-10)18(20,21)22)17-25-9-27(26-17)8-14(16(23)28)11-2-3-15(19)24-7-11/h2-9H,1H3,(H2,23,28)/b14-8- |
| InChIKey | AGCAEDQABXMXFX-ZSOIEALJSA-N |
| XLogP | 3.29 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|