C25H26F3N3O2 — CID 123747968
2-(8-ethyl-3-methylcyclonona-1,5,8-trien-1-yl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid (PubChem CID 123747968) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-(8-ethyl-3-methylcyclonona-1,5,8-trien-1-yl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid.
| Compound Name | 2-(8-ethyl-3-methylcyclonona-1,5,8-trien-1-yl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123747968 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(8-ethyl-3-methylcyclonona-1,5,8-trien-1-yl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
| SMILES | CCC1=CC(C(=Cn2cnc(-c3cc(C)cc(C(F)(F)F)c3)n2)C(=O)O)=CC(C)CC=CC1 |
| InChI | InChI=1S/C25H26F3N3O2/c1-4-18-8-6-5-7-16(2)9-19(12-18)22(24(32)33)14-31-15-29-23(30-31)20-10-17(3)11-21(13-20)25(26,27)28/h5-6,9-16H,4,7-8H2,1-3H3,(H,32,33) |
| InChIKey | HDPZUZXBCQJBEC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|