C14H14FN3O2S — CID 171388469
5-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]pyridin-2-amine (PubChem CID 171388469) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]pyridin-2-amine.
| Compound Name | 5-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 171388469 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 5-[4-(3-fluoroazetidin-1-yl)sulfonylphenyl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2ccc(S(=O)(=O)N3CC(F)C3)cc2)cn1 |
| InChI | InChI=1S/C14H14FN3O2S/c15-12-8-18(9-12)21(19,20)13-4-1-10(2-5-13)11-3-6-14(16)17-7-11/h1-7,12H,8-9H2,(H2,16,17) |
| InChIKey | ARZYKSZRFZICBQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |