C18H18N6O2 — CID 158679101
2-[2-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]-5-oxopyrazolidin-1-yl]acetonitrile (PubChem CID 158679101) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[2-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]-5-oxopyrazolidin-1-yl]acetonitrile.
| Compound Name | 2-[2-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]-5-oxopyrazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 158679101 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[2-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]-5-oxopyrazolidin-1-yl]acetonitrile |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C\C(=O)N3CCC(=O)N3CC#N)n2)c1 |
| InChI | InChI=1S/C18H18N6O2/c1-13-9-14(2)11-15(10-13)18-20-12-22(21-18)6-3-16(25)23-7-4-17(26)24(23)8-5-19/h3,6,9-12H,4,7-8H2,1-2H3/b6-3- |
| InChIKey | KQJZTJXHAVJXTC-UTCJRWHESA-N |
| XLogP | 1.53 |
| TPSA | 95.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|