C18H21N5O3 — CID 161209762
N'-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide (PubChem CID 161209762) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N'-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide.
| Compound Name | N'-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide |
|---|---|
| PubChem CID | 161209762 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N'-[(Z)-3-[3-(3,5-dimethylphenyl)-1,2,4-triazol-1-yl]prop-2-enoyl]oxolane-3-carbohydrazide |
| SMILES | Cc1cc(C)cc(-c2ncn(/C=C\C(=O)NNC(=O)C3CCOC3)n2)c1 |
| InChI | InChI=1S/C18H21N5O3/c1-12-7-13(2)9-15(8-12)17-19-11-23(22-17)5-3-16(24)20-21-18(25)14-4-6-26-10-14/h3,5,7-9,11,14H,4,6,10H2,1-2H3,(H,20,24)(H,21,25)/b5-3- |
| InChIKey | DMWDTBPMVYNMOT-HYXAFXHYSA-N |
| XLogP | 1.22 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|